Products 2609037-67-2
CAS 2609037-67-2 is the registry number for 8-Bromo-5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine (CAS 2609037-67-2) is a chemical compound with the molecular formula C7H4BrF2N3 and a molecular weight of 248.03 g/mol. IUPAC name: 8-bromo-5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: FBPYMMMQNDCHDG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2N3 |
|---|---|
| Molecular weight | 248.03 g/mol |
| IUPAC name | 8-bromo-5-(difluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | FBPYMMMQNDCHDG-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=NN2C(=C1)C(F)F)Br |
Computed by PubChem (NCBI)