Products 1393532-39-2
CAS 1393532-39-2 is the registry number for 3,3-Difluoro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one (CAS 1393532-39-2) is a chemical compound with the molecular formula C7H4F2N2O and a molecular weight of 170.12 g/mol. IUPAC name: 3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: WROZWVFIRDEOEE-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2O |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | WROZWVFIRDEOEE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C2(F)F)N=C1 |
Computed by PubChem (NCBI)