Products 1393534-10-5

CAS 1393534-10-5 is the registry number for 2-(4,6-Difluoropyridin-2-yl)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4,6-difluoro-2-pyridinyl)acetic acid (CAS 1393534-10-5) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2-(4,6-difluoro-2-pyridinyl)acetic acid. InChIKey: BXRKWOJZVBWVFN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5F2NO2
Molecular weight173.12 g/mol
IUPAC name2-(4,6-difluoro-2-pyridinyl)acetic acid
InChIKeyBXRKWOJZVBWVFN-UHFFFAOYSA-N
SMILESC1=C(C=C(N=C1CC(=O)O)F)F

Computed by PubChem (NCBI)