Products 1393539-86-0

CAS 1393539-86-0 is the registry number for 1-(2,2,2-Trifluoroethyl)-1H-1,2,3-triazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid (CAS 1393539-86-0) is a chemical compound with the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. IUPAC name: 3-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid. InChIKey: YUUOOQXLGBZQAB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4F3N3O2
Molecular weight195.10 g/mol
IUPAC name3-(2,2,2-trifluoroethyl)triazole-4-carboxylic acid
InChIKeyYUUOOQXLGBZQAB-UHFFFAOYSA-N
SMILESC1=C(N(N=N1)CC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)