CAS 1552738-09-6 is the registry number for 1-Methyl-3-(trifluoromethyl)-1h-1,2,4-triazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid (CAS 1552738-09-6) is a chemical compound with the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. IUPAC name: 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid. InChIKey: KBTIORFKJVWSAT-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O2 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid |
| InChIKey | KBTIORFKJVWSAT-UHFFFAOYSA-N |
| SMILES | CN1C(=NC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)