Products 1266841-66-0
CAS 1266841-66-0 appears in our catalog under these names: 1-Methyl-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%, 1-Methyl-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
1-methyl-5-(trifluoromethyl)triazole-4-carboxylic acid (CAS 1266841-66-0) is a chemical compound with the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. IUPAC name: 1-methyl-5-(trifluoromethyl)triazole-4-carboxylic acid. InChIKey: QLDVKXHHCZEGAU-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O2 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 1-methyl-5-(trifluoromethyl)triazole-4-carboxylic acid |
| InChIKey | QLDVKXHHCZEGAU-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)