CAS 1557626-89-7 is the registry number for [3-(Trifluoromethyl)-1h-1,2,4-triazol-1-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetic acid (CAS 1557626-89-7) is a chemical compound with the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. IUPAC name: 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetic acid. InChIKey: NVZGAIYKTMFGHH-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O2 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetic acid |
| InChIKey | NVZGAIYKTMFGHH-UHFFFAOYSA-N |
| SMILES | C1=NC(=NN1CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)