CAS 1707391-59-0 is the registry number for 4-methyl-5-(trifluoromethyl)-4H-1,2,4-triazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid (CAS 1707391-59-0) is a chemical compound with the molecular formula C5H4F3N3O2 and a molecular weight of 195.10 g/mol. IUPAC name: 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid. InChIKey: NUXALQDJDFNYIA-UHFFFAOYSA-N.
| Molecular formula | C5H4F3N3O2 |
|---|---|
| Molecular weight | 195.10 g/mol |
| IUPAC name | 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxylic acid |
| InChIKey | NUXALQDJDFNYIA-UHFFFAOYSA-N |
| SMILES | CN1C(=NN=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)