Products 1393546-30-9

CAS 1393546-30-9 is the registry number for 2-(Methoxycarbonyl)-6-(trifluoromethyl)isonicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methoxycarbonyl-6-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 1393546-30-9) is a chemical compound with the molecular formula C9H6F3NO4 and a molecular weight of 249.14 g/mol. IUPAC name: 2-methoxycarbonyl-6-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: ALNBVFCCONBEOV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6F3NO4
Molecular weight249.14 g/mol
IUPAC name2-methoxycarbonyl-6-(trifluoromethyl)pyridine-4-carboxylic acid
InChIKeyALNBVFCCONBEOV-UHFFFAOYSA-N
SMILESCOC(=O)C1=NC(=CC(=C1)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)