CAS 957207-00-0 is the registry number for Methyl 4-nitro-3-(trifluoromethyl)benzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 25g.
Methyl 4-nitro-3-(trifluoromethyl)benzoate (CAS 957207-00-0) is a chemical compound with the molecular formula C9H6F3NO4 and a molecular weight of 249.14 g/mol. IUPAC name: methyl 4-nitro-3-(trifluoromethyl)benzoate. InChIKey: WLCQMMCPINDPIB-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO4 |
|---|---|
| Molecular weight | 249.14 g/mol |
| IUPAC name | methyl 4-nitro-3-(trifluoromethyl)benzoate |
| InChIKey | WLCQMMCPINDPIB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)