CAS 199469-91-5 appears in our catalog under these names: 4-Nitro-2-(trifluoromethyl)phenylacetic acid, 98%, 2-(4-Nitro-2-(trifluoromethyl)phenyl)acetic acid 95%, 4-Nitro-2-(trifluoromethyl)benzeneacetic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
2-[4-nitro-2-(trifluoromethyl)phenyl]acetic acid (CAS 199469-91-5) is a chemical compound with the molecular formula C9H6F3NO4 and a molecular weight of 249.14 g/mol. IUPAC name: 2-[4-nitro-2-(trifluoromethyl)phenyl]acetic acid. InChIKey: WWYLSNCPPXAEER-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO4 |
|---|---|
| Molecular weight | 249.14 g/mol |
| IUPAC name | 2-[4-nitro-2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | WWYLSNCPPXAEER-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)