CAS 927801-01-2 appears in our catalog under these names: 2-Nitro-5-(trifluoromethyl)phenylacetic acid, 96%, 2-Nitro-5-(trifluoromethyl)phenylacetic acid 98%, 2-Nitro-5-(trifluoromethyl)phenylacetic acid, 98%, 2-Nitro-5-(trifluoromethyl)phenylacetic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
2-[2-nitro-5-(trifluoromethyl)phenyl]acetic acid (CAS 927801-01-2) is a chemical compound with the molecular formula C9H6F3NO4 and a molecular weight of 249.14 g/mol. IUPAC name: 2-[2-nitro-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: LOJIRIPMRUCZMI-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO4 |
|---|---|
| Molecular weight | 249.14 g/mol |
| IUPAC name | 2-[2-nitro-5-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | LOJIRIPMRUCZMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)