Products 1393546-36-5
CAS 1393546-36-5 is the registry number for 1-(3-Amino-6-(trifluoromethyl)pyridin-2-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-[3-amino-6-(trifluoromethyl)-2-pyridinyl]ethanone (CAS 1393546-36-5) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: 1-[3-amino-6-(trifluoromethyl)-2-pyridinyl]ethanone. InChIKey: LYOXCNSKYREHRX-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 1-[3-amino-6-(trifluoromethyl)-2-pyridinyl]ethanone |
| InChIKey | LYOXCNSKYREHRX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=N1)C(F)(F)F)N |
Computed by PubChem (NCBI)