CAS 1393551-82-0 is the registry number for 3-Nitro-5,6,7,8-tetrahydro-1,6-naphthyridin-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-nitro-7,8-dihydro-6H-1,6-naphthyridin-5-one (CAS 1393551-82-0) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 3-nitro-7,8-dihydro-6H-1,6-naphthyridin-5-one. InChIKey: SGIORKLHQSWESR-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-nitro-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| InChIKey | SGIORKLHQSWESR-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1N=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)