Products 139395-94-1
CAS 139395-94-1 appears in our catalog under these names: Valdecoxib Impurity 4, Parecoxib Impurity 13, 3-Phenyl-4-benzyl-5-methylisoxazole. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-benzyl-5-methyl-3-phenyl-1,2-oxazole (CAS 139395-94-1) is a chemical compound with the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. IUPAC name: 4-benzyl-5-methyl-3-phenyl-1,2-oxazole. InChIKey: SIXLWQCEAXLZHT-UHFFFAOYSA-N.
| Molecular formula | C17H15NO |
|---|---|
| Molecular weight | 249.31 g/mol |
| IUPAC name | 4-benzyl-5-methyl-3-phenyl-1,2-oxazole |
| InChIKey | SIXLWQCEAXLZHT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)