CAS 139399-62-5 appears in our catalog under these names: 3-Bromoquinolin-8-ol, 95%, 3-bromoquinolin-8-ol, 3-Bromoquinolin-8-ol 95%, 3-Bromoquinolin-8-ol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 50mg, 500mg, 1000mg.
3-bromoquinolin-8-ol (CAS 139399-62-5) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 3-bromoquinolin-8-ol. InChIKey: VYGIVXTVBNTOLP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 3-bromoquinolin-8-ol |
| InChIKey | VYGIVXTVBNTOLP-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)O)Br |
Computed by PubChem (NCBI)