CAS 139399-64-7 appears in our catalog under these names: 6-Bromo-8-quinolinol, 6-Bromoquinolin-8-ol 95%, 6-bromoquinolin-8-ol, 98%, 98%, 6-BROMOQUINOLIN-8-OL, 95%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg.
6-bromoquinolin-8-ol (CAS 139399-64-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 6-bromoquinolin-8-ol. InChIKey: IMUJTAIQEBHAMT-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 6-bromoquinolin-8-ol |
| InChIKey | IMUJTAIQEBHAMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)O)Br |
Computed by PubChem (NCBI)