CAS 1394040-09-5 is the registry number for 2-Carbamoylpiperidine-4-carboxylic Acid Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
2-carbamoylpiperidine-4-carboxylic acid;hydrochloride (CAS 1394040-09-5) is a chemical compound with the molecular formula C7H13ClN2O3 and a molecular weight of 208.64 g/mol. IUPAC name: 2-carbamoylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: UECLMVQBBSPOFH-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN2O3 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-carbamoylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | UECLMVQBBSPOFH-UHFFFAOYSA-N |
| SMILES | C1CNC(CC1C(=O)O)C(=O)N.Cl |
Computed by PubChem (NCBI)