Products 1609407-75-1
CAS 1609407-75-1 is the registry number for 1-(Aminocarbonyl)-3-piperidinecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-carbamoylpiperidine-3-carboxylic acid;hydrochloride (CAS 1609407-75-1) is a chemical compound with the molecular formula C7H13ClN2O3 and a molecular weight of 208.64 g/mol. IUPAC name: 1-carbamoylpiperidine-3-carboxylic acid;hydrochloride. InChIKey: KKQDGNJPNRLBEU-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN2O3 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 1-carbamoylpiperidine-3-carboxylic acid;hydrochloride |
| InChIKey | KKQDGNJPNRLBEU-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)