Products 3026670-17-4
CAS 3026670-17-4 is the registry number for methyl 4-amino-2-oxo-piperidine-4-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl 4-amino-2-oxopiperidine-4-carboxylate;hydrochloride (CAS 3026670-17-4) is a chemical compound with the molecular formula C7H13ClN2O3 and a molecular weight of 208.64 g/mol. IUPAC name: methyl 4-amino-2-oxopiperidine-4-carboxylate;hydrochloride. InChIKey: ZXYMTVJWYMPWOQ-UHFFFAOYSA-N.
| Molecular formula | C7H13ClN2O3 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | methyl 4-amino-2-oxopiperidine-4-carboxylate;hydrochloride |
| InChIKey | ZXYMTVJWYMPWOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCNC(=O)C1)N.Cl |
Computed by PubChem (NCBI)