CAS 20584-81-0 is the registry number for NCAO, 98.07%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg.
(2S)-2-amino-5-[(2-chloroacetyl)amino]pentanoic acid (CAS 20584-81-0) is a chemical compound with the molecular formula C7H13ClN2O3 and a molecular weight of 208.64 g/mol. IUPAC name: (2S)-2-amino-5-[(2-chloroacetyl)amino]pentanoic acid. InChIKey: YOHUBSGWLQBGKD-YFKPBYRVSA-N.
| Molecular formula | C7H13ClN2O3 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | (2S)-2-amino-5-[(2-chloroacetyl)amino]pentanoic acid |
| InChIKey | YOHUBSGWLQBGKD-YFKPBYRVSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CNC(=O)CCl |
Computed by PubChem (NCBI)