Products 1394040-13-1
CAS 1394040-13-1 appears in our catalog under these names: 1-(Pyridin-3-yl)-1h-pyrazole-4-carboxylic acid hydrochloride, 95%, 1-(Pyridin-3-yl)-1H-pyrazole-4-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g.
1-pyridin-3-ylpyrazole-4-carboxylic acid;hydrochloride (CAS 1394040-13-1) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: 1-pyridin-3-ylpyrazole-4-carboxylic acid;hydrochloride. InChIKey: FKLMICNLWVBTRT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 1-pyridin-3-ylpyrazole-4-carboxylic acid;hydrochloride |
| InChIKey | FKLMICNLWVBTRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)N2C=C(C=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)