CAS 1394041-98-5 appears in our catalog under these names: 1-(Propan-2-yl)-1H-indazole-5-sulfonamide, 1-(Propan-2-yl)-1H-indazole-5-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
1-propan-2-ylindazole-5-sulfonamide (CAS 1394041-98-5) is a chemical compound with the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. IUPAC name: 1-propan-2-ylindazole-5-sulfonamide. InChIKey: PTEZORUMFKQJPT-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2S |
|---|---|
| Molecular weight | 239.30 g/mol |
| IUPAC name | 1-propan-2-ylindazole-5-sulfonamide |
| InChIKey | PTEZORUMFKQJPT-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C=C(C=C2)S(=O)(=O)N)C=N1 |
Computed by PubChem (NCBI)