Products 1394051-23-0
CAS 1394051-23-0 is the registry number for (1R)-1-(1-Benzyl-1H-pyrazol-4-yl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R)-1-(1-benzylpyrazol-4-yl)ethanol (CAS 1394051-23-0) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: (1R)-1-(1-benzylpyrazol-4-yl)ethanol. InChIKey: QVEMHCYFAUDBND-SNVBAGLBSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (1R)-1-(1-benzylpyrazol-4-yl)ethanol |
| InChIKey | QVEMHCYFAUDBND-SNVBAGLBSA-N |
| SMILES | C[C@H](C1=CN(N=C1)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)