CAS 139487-07-3 is the registry number for 6-(Bromomethyl)-3-methyl-2,3-dihydro-1,3-benzothiazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(bromomethyl)-3-methyl-1,3-benzothiazol-2-one (CAS 139487-07-3) is a chemical compound with the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. IUPAC name: 6-(bromomethyl)-3-methyl-1,3-benzothiazol-2-one. InChIKey: GSAPDPCHDJTVQB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNOS |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 6-(bromomethyl)-3-methyl-1,3-benzothiazol-2-one |
| InChIKey | GSAPDPCHDJTVQB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)CBr)SC1=O |
Computed by PubChem (NCBI)