CAS 1395101-69-5 appears in our catalog under these names: tert-Butyl 4-(3-formyl-4-nitrophenyl)-piperazine-1-carboxylate, 95%, TERT–BUTYL 4–(3–FORMYL–4–NITROPHENYL)–PIPERAZINE–1–CARBOXYLATE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl 4-(3-formyl-4-nitrophenyl)piperazine-1-carboxylate (CAS 1395101-69-5) is a chemical compound with the molecular formula C16H21N3O5 and a molecular weight of 335.35 g/mol. IUPAC name: tert-butyl 4-(3-formyl-4-nitrophenyl)piperazine-1-carboxylate. InChIKey: VPZYLGFMALHYGS-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O5 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | tert-butyl 4-(3-formyl-4-nitrophenyl)piperazine-1-carboxylate |
| InChIKey | VPZYLGFMALHYGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=C(C=C2)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)