CAS 1803566-92-8 appears in our catalog under these names: 1-Phenyl-3-(piperazin-1-yl)pyrrolidin-2-one oxalate, 95%, 1-Phenyl-3-(piperazin-1-yl)pyrrolidin-2-one, oxalic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Oxalic acid;1-phenyl-3-piperazin-1-ylpyrrolidin-2-one (CAS 1803566-92-8) is a chemical compound with the molecular formula C16H21N3O5 and a molecular weight of 335.35 g/mol. IUPAC name: oxalic acid;1-phenyl-3-piperazin-1-ylpyrrolidin-2-one. InChIKey: JLKFZUBRGIYWEA-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O5 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | oxalic acid;1-phenyl-3-piperazin-1-ylpyrrolidin-2-one |
| InChIKey | JLKFZUBRGIYWEA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1N2CCNCC2)C3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)