Products 97885-49-9
CAS 97885-49-9 is the registry number for (S)-tert-Butyl 2-((4-nitrophenyl)carbamoyl)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate (CAS 97885-49-9) is a chemical compound with the molecular formula C16H21N3O5 and a molecular weight of 335.35 g/mol. IUPAC name: tert-butyl (2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate. InChIKey: MGSPREPYCVTJKZ-ZDUSSCGKSA-N.
| Molecular formula | C16H21N3O5 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| InChIKey | MGSPREPYCVTJKZ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)