CAS 389628-56-2 is the registry number for tert-Butyl 4-(3-nitrobenzoyl)piperazine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 4-(3-nitrobenzoyl)piperazine-1-carboxylate (CAS 389628-56-2) is a chemical compound with the molecular formula C16H21N3O5 and a molecular weight of 335.35 g/mol. IUPAC name: tert-butyl 4-(3-nitrobenzoyl)piperazine-1-carboxylate. InChIKey: UHLSOPRZANQQOA-UHFFFAOYSA-N.
| Molecular formula | C16H21N3O5 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | tert-butyl 4-(3-nitrobenzoyl)piperazine-1-carboxylate |
| InChIKey | UHLSOPRZANQQOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)