CAS 139525-77-2 appears in our catalog under these names: 2–(7–methoxynaphthalen–1–yl)ethanamine,hydrochloride, 2-(7-Methoxy-1-naphthyl)ethylamine HCl, 2-(7-Methoxynaphthalen-1-yl)ethanaminehydrochloride, 97%, 2-(7-Methoxynaphthalen-1-yl)ethanamine hydrochloride, 97%, Agomelatine Impurity A HCl. Offered by: GLPBio, TargetMol, Fluorochem, AmBeed, Chemat Brand. Available pack sizes: 10g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(7-methoxynaphthalen-1-yl)ethanamine;hydrochloride (CAS 139525-77-2) is a chemical compound with the molecular formula C13H16ClNO and a molecular weight of 237.72 g/mol. IUPAC name: 2-(7-methoxynaphthalen-1-yl)ethanamine;hydrochloride. InChIKey: HPYGZUDDGWEYDQ-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO |
|---|---|
| Molecular weight | 237.72 g/mol |
| IUPAC name | 2-(7-methoxynaphthalen-1-yl)ethanamine;hydrochloride |
| InChIKey | HPYGZUDDGWEYDQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC=C2CCN)C=C1.Cl |
Computed by PubChem (NCBI)