Products 1396777-67-5
CAS 1396777-67-5 is the registry number for 6'-Bromo-2',3'-dihydrospiro[cyclopropane-1,1'-indene], 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-bromospiro[1,2-dihydroindene-3,1'-cyclopropane] (CAS 1396777-67-5) is a chemical compound with the molecular formula C11H11Br and a molecular weight of 223.11 g/mol. IUPAC name: 5-bromospiro[1,2-dihydroindene-3,1'-cyclopropane]. InChIKey: VGGUSHOQNWZMRO-UHFFFAOYSA-N.
| Molecular formula | C11H11Br |
|---|---|
| Molecular weight | 223.11 g/mol |
| IUPAC name | 5-bromospiro[1,2-dihydroindene-3,1'-cyclopropane] |
| InChIKey | VGGUSHOQNWZMRO-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)