CAS 1396965-93-7 is the registry number for 2-(2,3-Dihydro-1,4-benzodioxine-6-sulfonamido)-3-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoic acid (CAS 1396965-93-7) is a chemical compound with the molecular formula C13H17NO6S and a molecular weight of 315.34 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoic acid. InChIKey: MPTAGPDKOCKSRA-UHFFFAOYSA-N.
| Molecular formula | C13H17NO6S |
|---|---|
| Molecular weight | 315.34 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-3-methylbutanoic acid |
| InChIKey | MPTAGPDKOCKSRA-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NS(=O)(=O)C1=CC2=C(C=C1)OCCO2 |
Computed by PubChem (NCBI)