CAS 1858251-37-2 is the registry number for Methyl n-(2,3-dihydro-1,4-benzodioxin-6-yl)-n-(ethylsulfonyl)glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetate (CAS 1858251-37-2) is a chemical compound with the molecular formula C13H17NO6S and a molecular weight of 315.34 g/mol. IUPAC name: methyl 2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetate. InChIKey: UJTNCMQURUWXFF-UHFFFAOYSA-N.
| Molecular formula | C13H17NO6S |
|---|---|
| Molecular weight | 315.34 g/mol |
| IUPAC name | methyl 2-[2,3-dihydro-1,4-benzodioxin-6-yl(ethylsulfonyl)amino]acetate |
| InChIKey | UJTNCMQURUWXFF-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N(CC(=O)OC)C1=CC2=C(C=C1)OCCO2 |
Computed by PubChem (NCBI)