Products 82609-39-0

CAS 82609-39-0 is the registry number for Cbz-DL-Abu(SO2Me)-OH, 98%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-methylsulfonyl-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 82609-39-0) is a chemical compound with the molecular formula C13H17NO6S and a molecular weight of 315.34 g/mol. IUPAC name: 4-methylsulfonyl-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: NQBRKHHSCUAJBE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO6S
Molecular weight315.34 g/mol
IUPAC name4-methylsulfonyl-2-(phenylmethoxycarbonylamino)butanoic acid
InChIKeyNQBRKHHSCUAJBE-UHFFFAOYSA-N
SMILESCS(=O)(=O)CCC(C(=O)O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)