Products 721418-09-3

CAS 721418-09-3 is the registry number for [4-Methoxy-3-(morpholine-4-sulfonyl)-phenyl]-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetic acid (CAS 721418-09-3) is a chemical compound with the molecular formula C13H17NO6S and a molecular weight of 315.34 g/mol. IUPAC name: 2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetic acid. InChIKey: RPZLZRBTEXGDMP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO6S
Molecular weight315.34 g/mol
IUPAC name2-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetic acid
InChIKeyRPZLZRBTEXGDMP-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CC(=O)O)S(=O)(=O)N2CCOCC2

Computed by PubChem (NCBI)