CAS 1396979-05-7 appears in our catalog under these names: 2-[(4-Chlorophenyl)amino]propanohydrazide, 95%, 2-((4-Chlorophenyl)amino)propanehydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 5g.
2-(4-chloroanilino)propanehydrazide (CAS 1396979-05-7) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 2-(4-chloroanilino)propanehydrazide. InChIKey: KDGOMNYOAFIEOI-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-(4-chloroanilino)propanehydrazide |
| InChIKey | KDGOMNYOAFIEOI-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NN)NC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)