Products 1396999-37-3
CAS 1396999-37-3 appears in our catalog under these names: 2-((3-Bromophenyl)formamido)-3-hydroxypropanoic acid, 2-((3-Bromophenyl)formamido)-3-hydroxypropanoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
2-[(3-bromobenzoyl)amino]-3-hydroxypropanoic acid (CAS 1396999-37-3) is a chemical compound with the molecular formula C10H10BrNO4 and a molecular weight of 288.09 g/mol. IUPAC name: 2-[(3-bromobenzoyl)amino]-3-hydroxypropanoic acid. InChIKey: GZDCHOSSDQRVNM-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO4 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | 2-[(3-bromobenzoyl)amino]-3-hydroxypropanoic acid |
| InChIKey | GZDCHOSSDQRVNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)NC(CO)C(=O)O |
Computed by PubChem (NCBI)