Products 1397194-60-3
CAS 1397194-60-3 is the registry number for Benzo(k)fluoranthene-13C6. Offered by: TRC. Available pack sizes: 25mg.
Benzo[k]fluoranthene (CAS 1397194-60-3) is a chemical compound with the molecular formula C20H12 and a molecular weight of 258.26 g/mol. IUPAC name: benzo[k]fluoranthene. InChIKey: HAXBIWFMXWRORI-CQZVIDJFSA-N.
| Molecular formula | C20H12 |
|---|---|
| Molecular weight | 258.26 g/mol |
| IUPAC name | benzo[k]fluoranthene |
| InChIKey | HAXBIWFMXWRORI-CQZVIDJFSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=C[13C]5=[13CH][13CH]=[13CH][13CH]=[13C]5C=C4C3=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
Benzo[k]fluoranthene-13C6, Benzo[k]fluoranthene-