Products 1397199-87-9
CAS 1397199-87-9 appears in our catalog under these names: 5-Bromo-imidazo[1,2-a]pyridine-3-carboxylic acid ethyl ester, 95%, 5-BRomo-imidazo(1,2-a)pyridine-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g, 5g, 25g.
Ethyl 5-bromoimidazo[1,2-a]pyridine-3-carboxylate (CAS 1397199-87-9) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 5-bromoimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: NNSQOKQDBHWCIU-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 5-bromoimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | NNSQOKQDBHWCIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N1C(=CC=C2)Br |
Computed by PubChem (NCBI)