CAS 139725-18-1 is the registry number for 4-Nitro-2-(1-phenylethyl)-1h-isoindole-1,3(2h)-dione, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-nitro-2-(1-phenylethyl)isoindole-1,3-dione (CAS 139725-18-1) is a chemical compound with the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. IUPAC name: 4-nitro-2-(1-phenylethyl)isoindole-1,3-dione. InChIKey: ZQYVFBYTYFPDJZ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O4 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | 4-nitro-2-(1-phenylethyl)isoindole-1,3-dione |
| InChIKey | ZQYVFBYTYFPDJZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C(=O)C3=C(C2=O)C(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)