Products 775304-03-5

CAS 775304-03-5 is the registry number for Ataluren Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[5-(2-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 775304-03-5) is a chemical compound with the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. IUPAC name: 3-[5-(2-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: CLYHTPXHDRMNTN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H12N2O4
Molecular weight296.28 g/mol
IUPAC name3-[5-(2-methoxyphenyl)-1,2,4-oxadiazol-3-yl]benzoic acid
InChIKeyCLYHTPXHDRMNTN-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C2=NC(=NO2)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)