CAS 341556-82-9 is the registry number for (2E,2'E)-3,3'-([2,2'-Bipyridine]-5,5'-diyl)diacrylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[6-[5-[(E)-2-carboxyethenyl]-2-pyridinyl]-3-pyridinyl]prop-2-enoic acid (CAS 341556-82-9) is a chemical compound with the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. IUPAC name: (E)-3-[6-[5-[(E)-2-carboxyethenyl]-2-pyridinyl]-3-pyridinyl]prop-2-enoic acid. InChIKey: LPHLIHYCPMUNTL-FCXRPNKRSA-N.
| Molecular formula | C16H12N2O4 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | (E)-3-[6-[5-[(E)-2-carboxyethenyl]-2-pyridinyl]-3-pyridinyl]prop-2-enoic acid |
| InChIKey | LPHLIHYCPMUNTL-FCXRPNKRSA-N |
| SMILES | C1=CC(=NC=C1/C=C/C(=O)O)C2=NC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)