CAS 87259-89-0 appears in our catalog under these names: (1E,3E)-1,4-Bis(2-nitrophenyl)buta-1,3-diene, 95%, (1E,3E)-1,4-Bis(2-nitrophenyl)buta-1,3-diene, 95+%, (1E,3E)–1,4–Bis(2–nitrophenyl)buta–1,3–diene. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg.
1-nitro-2-[(1E,3E)-4-(2-nitrophenyl)buta-1,3-dienyl]benzene (CAS 87259-89-0) is a chemical compound with the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. IUPAC name: 1-nitro-2-[(1E,3E)-4-(2-nitrophenyl)buta-1,3-dienyl]benzene. InChIKey: NOBVYURTQVHAAH-FACPPWRESA-N.
| Molecular formula | C16H12N2O4 |
|---|---|
| Molecular weight | 296.28 g/mol |
| IUPAC name | 1-nitro-2-[(1E,3E)-4-(2-nitrophenyl)buta-1,3-dienyl]benzene |
| InChIKey | NOBVYURTQVHAAH-FACPPWRESA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C=C/C2=CC=CC=C2[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)