Products 1397526-04-3
CAS 1397526-04-3 is the registry number for 6,7,8,9-Tetrahydro-5H-cyclohepta[b]pyridine-5,9-diol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5,9-diol (CAS 1397526-04-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5,9-diol. InChIKey: BVMHNLOZCJFYQM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-5,9-diol |
| InChIKey | BVMHNLOZCJFYQM-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C(C1)O)N=CC=C2)O |
Computed by PubChem (NCBI)