CAS 139768-71-1 appears in our catalog under these names: 4-Benzyloxyphenyl isothiocyanate, 95%, 4-Benzyloxyphenylisothiocyanate, 97%, 4–Benzyloxyphenyl isothiocyanate, 4-(Benzyloxy)phenyl isothiocyanate, 97% . Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific. Available pack sizes: 1g, 5g, 10g.
1-isothiocyanato-4-phenylmethoxybenzene (CAS 139768-71-1) is a chemical compound with the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. IUPAC name: 1-isothiocyanato-4-phenylmethoxybenzene. InChIKey: OQXRBXAFSXVCCO-UHFFFAOYSA-N.
| Molecular formula | C14H11NOS |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 1-isothiocyanato-4-phenylmethoxybenzene |
| InChIKey | OQXRBXAFSXVCCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)