CAS 206761-68-4 is the registry number for (2-Methoxy-5-phenyl)phenyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-isothiocyanato-1-methoxy-4-phenylbenzene (CAS 206761-68-4) is a chemical compound with the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. IUPAC name: 2-isothiocyanato-1-methoxy-4-phenylbenzene. InChIKey: TZRMLJYZKZTEFW-UHFFFAOYSA-N.
| Molecular formula | C14H11NOS |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 2-isothiocyanato-1-methoxy-4-phenylbenzene |
| InChIKey | TZRMLJYZKZTEFW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=CC=C2)N=C=S |
Computed by PubChem (NCBI)