CAS 421553-47-1 is the registry number for (4-(Benzo(d)thiazol-2-yl)phenyl)methanol, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
[4-(1,3-benzothiazol-2-yl)phenyl]methanol (CAS 421553-47-1) is a chemical compound with the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. IUPAC name: [4-(1,3-benzothiazol-2-yl)phenyl]methanol. InChIKey: YUNQTXCQGCOSNG-UHFFFAOYSA-N.
| Molecular formula | C14H11NOS |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | [4-(1,3-benzothiazol-2-yl)phenyl]methanol |
| InChIKey | YUNQTXCQGCOSNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(C=C3)CO |
Computed by PubChem (NCBI)