CAS 206559-36-6 appears in our catalog under these names: 3–Benzyloxyphenyl isothiocyanate, 3-Benzyloxyphenyl isothiocyanate, 97% , 3-Benzyloxyphenylisothiocyanate 97%, 3-Benzyloxyphenyl isothiocyanate, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 25g, 100mg, 1g.
1-isothiocyanato-3-phenylmethoxybenzene (CAS 206559-36-6) is a chemical compound with the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. IUPAC name: 1-isothiocyanato-3-phenylmethoxybenzene. InChIKey: QJLFNDXMZQJMDL-UHFFFAOYSA-N.
| Molecular formula | C14H11NOS |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 1-isothiocyanato-3-phenylmethoxybenzene |
| InChIKey | QJLFNDXMZQJMDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)N=C=S |
Computed by PubChem (NCBI)