Products 1398065-51-4
CAS 1398065-51-4 appears in our catalog under these names: 3-(3-Ethoxy-4-methoxyphenyl)propionic-2,2,3,3-d4, 3-(3-Ethoxy-4-methoxyphenyl)propionic-2,2,3,3-d4 Acid, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,1g, 0,05g.
2,2,3,3-tetradeuterio-3-(3-ethoxy-4-methoxyphenyl)propanoic acid (CAS 1398065-51-4) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 228.28 g/mol. IUPAC name: 2,2,3,3-tetradeuterio-3-(3-ethoxy-4-methoxyphenyl)propanoic acid. InChIKey: XOHHVCSPHJILQB-CWUGWKFWSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | 2,2,3,3-tetradeuterio-3-(3-ethoxy-4-methoxyphenyl)propanoic acid |
| InChIKey | XOHHVCSPHJILQB-CWUGWKFWSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)OC)OCC)C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)