Products 65494-95-3
CAS 65494-95-3 is the registry number for N6-Methyl-xylo-adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol (CAS 65494-95-3) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol. InChIKey: VQAYFKKCNSOZKM-GZCUOZMLSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(hydroxymethyl)-5-[6-(methylamino)purin-9-yl]oxolane-3,4-diol |
| InChIKey | VQAYFKKCNSOZKM-GZCUOZMLSA-N |
| SMILES | CNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)